About acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene
acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene (PubChem CID 175034373) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene.
Molecular Properties
| Compound Name | acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
| PubChem CID | 175034373 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
| SMILES | CC(N)=O.COc1cc2ccc1o2 |
| InChI | InChI=1S/C7H6O2.C2H5NO/c1-8-7-4-5-2-3-6(7)9-5;1-2(3)4/h2-4H,1H3;1H3,(H2,3,4) |
| InChIKey | LFAHXMRDZOLCQA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
The IUPAC name of acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene (CID 175034373) is acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene.
What is the SMILES notation for acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
The canonical SMILES for acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene is CC(N)=O.COc1cc2ccc1o2.
What is the InChIKey of acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
The InChIKey is LFAHXMRDZOLCQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H5NO/c1-8-7-4-5-2-3-6(7)9-5;1-2(3)4/h2-4H,1H3;1H3,(H2,3,4).
What are the key properties of acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene?
acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene has a molecular weight of 181.19 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;2-methoxy-7-oxabicyclo[2.2.1]hepta-1,3,5-triene is sourced from PubChem (CID 175034373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).