About alumanyl acetate;isocyanic acid
alumanyl acetate;isocyanic acid (PubChem CID 175034447) has the molecular formula C4H7AlN2O4
and a molecular weight of 174.09 g/mol. Its IUPAC name is alumanyl acetate;isocyanic acid.
Molecular Properties
| Compound Name | alumanyl acetate;isocyanic acid |
| PubChem CID | 175034447 |
| Molecular Formula | C4H7AlN2O4 |
| Molecular Weight | 174.09 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | alumanyl acetate;isocyanic acid |
| SMILES | CC(=O)O[AlH2].N=C=O.N=C=O |
| InChI | InChI=1S/C2H4O2.2CHNO.Al.2H/c1-2(3)4;2*2-1-3;;;/h1H3,(H,3,4);2*2H;;;/q;;;+1;;/p-1 |
| InChIKey | NYJXAGXPUYPBDU-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.09 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze alumanyl acetate;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumanyl acetate;isocyanic acid?
The IUPAC name of alumanyl acetate;isocyanic acid (CID 175034447) is alumanyl acetate;isocyanic acid.
What is the SMILES notation for alumanyl acetate;isocyanic acid?
The canonical SMILES for alumanyl acetate;isocyanic acid is CC(=O)O[AlH2].N=C=O.N=C=O.
What is the InChIKey of alumanyl acetate;isocyanic acid?
The InChIKey is NYJXAGXPUYPBDU-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.2CHNO.Al.2H/c1-2(3)4;2*2-1-3;;;/h1H3,(H,3,4);2*2H;;;/q;;;+1;;/p-1.
What are the key properties of alumanyl acetate;isocyanic acid?
alumanyl acetate;isocyanic acid has a molecular weight of 174.09 g/mol, XLogP of -1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for alumanyl acetate;isocyanic acid is sourced from PubChem (CID 175034447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).