C10H11F7 — CID 175034555
1,2,3,4,5,5,6-heptafluoro-4-methyl-3-propan-2-ylcyclohexene (PubChem CID 175034555) has the molecular formula C10H11F7 and a molecular weight of 264.18 g/mol. Its IUPAC name is 1,2,3,4,5,5,6-heptafluoro-4-methyl-3-propan-2-ylcyclohexene.
| Compound Name | 1,2,3,4,5,5,6-heptafluoro-4-methyl-3-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 175034555 |
| Molecular Formula | C10H11F7 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1,2,3,4,5,5,6-heptafluoro-4-methyl-3-propan-2-ylcyclohexene |
| SMILES | CC(C)C1(F)C(F)=C(F)C(F)C(F)(F)C1(C)F |
| InChI | InChI=1S/C10H11F7/c1-4(2)9(15)6(12)5(11)7(13)10(16,17)8(9,3)14/h4,7H,1-3H3 |
| InChIKey | FHGIPEOTATXKRJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |