About 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole
1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole (PubChem CID 175034904) has the molecular formula C22H24N2O
and a molecular weight of 332.45 g/mol. Its IUPAC name is 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole.
Molecular Properties
| Compound Name | 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole |
| PubChem CID | 175034904 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole |
| SMILES | C=CC1CCN(C=C)C1=O.CCc1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C14H13N.C8H11NO/c1-2-10-7-8-12-11-5-3-4-6-13(11)15-14(12)9-10;1-3-7-5-6-9(4-2)8(7)10/h3-9,15H,2H2,1H3;3-4,7H,1-2,5-6H2 |
| InChIKey | IAXVXYGGMTVMPJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole?
The IUPAC name of 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole (CID 175034904) is 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole.
What is the SMILES notation for 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole?
The canonical SMILES for 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole is C=CC1CCN(C=C)C1=O.CCc1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole?
The InChIKey is IAXVXYGGMTVMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N.C8H11NO/c1-2-10-7-8-12-11-5-3-4-6-13(11)15-14(12)9-10;1-3-7-5-6-9(4-2)8(7)10/h3-9,15H,2H2,1H3;3-4,7H,1-2,5-6H2.
What are the key properties of 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole?
1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole has a molecular weight of 332.45 g/mol, XLogP of 5.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(ethenyl)pyrrolidin-2-one;2-ethyl-9H-carbazole is sourced from PubChem (CID 175034904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).