About (3-ethenylcyclohexyl) carbamate
(3-ethenylcyclohexyl) carbamate (PubChem CID 175034930) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is (3-ethenylcyclohexyl) carbamate.
Molecular Properties
| Compound Name | (3-ethenylcyclohexyl) carbamate |
| PubChem CID | 175034930 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (3-ethenylcyclohexyl) carbamate |
| SMILES | C=CC1CCCC(OC(N)=O)C1 |
| InChI | InChI=1S/C9H15NO2/c1-2-7-4-3-5-8(6-7)12-9(10)11/h2,7-8H,1,3-6H2,(H2,10,11) |
| InChIKey | JYKQRYKKAVZODS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-ethenylcyclohexyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethenylcyclohexyl) carbamate?
The IUPAC name of (3-ethenylcyclohexyl) carbamate (CID 175034930) is (3-ethenylcyclohexyl) carbamate.
What is the SMILES notation for (3-ethenylcyclohexyl) carbamate?
The canonical SMILES for (3-ethenylcyclohexyl) carbamate is C=CC1CCCC(OC(N)=O)C1.
What is the InChIKey of (3-ethenylcyclohexyl) carbamate?
The InChIKey is JYKQRYKKAVZODS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-2-7-4-3-5-8(6-7)12-9(10)11/h2,7-8H,1,3-6H2,(H2,10,11).
What are the key properties of (3-ethenylcyclohexyl) carbamate?
(3-ethenylcyclohexyl) carbamate has a molecular weight of 169.22 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethenylcyclohexyl) carbamate is sourced from PubChem (CID 175034930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).