C18H24N4 — CID 175036223
2,2-diphenylcyclohexane-1,1,3,3-tetramine (PubChem CID 175036223) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2,2-diphenylcyclohexane-1,1,3,3-tetramine.
| Compound Name | 2,2-diphenylcyclohexane-1,1,3,3-tetramine |
|---|---|
| PubChem CID | 175036223 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2,2-diphenylcyclohexane-1,1,3,3-tetramine |
| SMILES | NC1(N)CCCC(N)(N)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24N4/c19-16(20)12-7-13-17(21,22)18(16,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13,19-22H2 |
| InChIKey | VOTQSJKOEWBUAW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|