C19H25F17O3Si — CID 175036646
diethoxy-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,13,13,13-heptadecafluoro-2-methyltridecan-2-yl)oxy-methylsilane (PubChem CID 175036646) has the molecular formula C19H25F17O3Si and a molecular weight of 652.46 g/mol. Its IUPAC name is diethoxy-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,13,13,13-heptadecafluoro-2-methyltridecan-2-yl)oxy-methylsilane.
| Compound Name | diethoxy-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,13,13,13-heptadecafluoro-2-methyltridecan-2-yl)oxy-methylsilane |
|---|---|
| PubChem CID | 175036646 |
| Molecular Formula | C19H25F17O3Si |
| Molecular Weight | 652.46 g/mol |
| Exact Mass | 652.13 |
| IUPAC Name | diethoxy-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,13,13,13-heptadecafluoro-2-methyltridecan-2-yl)oxy-methylsilane |
| SMILES | CCO[Si](C)(OCC)OC(C)(C)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C19H25F17O3Si/c1-6-37-40(5,38-7-2)39-11(3,4)10-13(22,23)16(29,30)18(33,34)19(35,36)17(31,32)15(27,28)12(20,21)8-9-14(24,25)26/h6-10H2,1-5H3 |
| InChIKey | PKLIGMAEKCMYJI-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.46 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|