About ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride
ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride (PubChem CID 175037296) has the molecular formula C12H16ClNO2
and a molecular weight of 241.72 g/mol. Its IUPAC name is ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride |
| PubChem CID | 175037296 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C1\C=CC=C(C(=O)OCC)C1C1CC1 |
| InChI | InChI=1S/C12H15NO2.ClH/c1-2-15-12(14)9-4-3-5-10(13)11(9)8-6-7-8;/h3-5,8,11,13H,2,6-7H2,1H3;1H/b13-10+; |
| InChIKey | IFGVXASNIPRURZ-RSGUCCNWSA-N |
| XLogP | 2.51 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride?
The IUPAC name of ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride (CID 175037296) is ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride?
The canonical SMILES for ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride is Cl.[H]/N=C1\C=CC=C(C(=O)OCC)C1C1CC1.
What is the InChIKey of ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride?
The InChIKey is IFGVXASNIPRURZ-RSGUCCNWSA-N. The full InChI is InChI=1S/C12H15NO2.ClH/c1-2-15-12(14)9-4-3-5-10(13)11(9)8-6-7-8;/h3-5,8,11,13H,2,6-7H2,1H3;1H/b13-10+;.
What are the key properties of ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride?
ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride has a molecular weight of 241.72 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-cyclopropyl-5-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride is sourced from PubChem (CID 175037296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).