About 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate
2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate (PubChem CID 175037316) has the molecular formula C7H15N2O4P
and a molecular weight of 222.18 g/mol. Its IUPAC name is 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate.
Molecular Properties
| Compound Name | 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate |
| PubChem CID | 175037316 |
| Molecular Formula | C7H15N2O4P |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate |
| SMILES | CCOP(=O)(O)O.Cc1cnc(C)[nH]1 |
| InChI | InChI=1S/C5H8N2.C2H7O4P/c1-4-3-6-5(2)7-4;1-2-6-7(3,4)5/h3H,1-2H3,(H,6,7);2H2,1H3,(H2,3,4,5) |
| InChIKey | ISOHLLYMOBRJIH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate?
The IUPAC name of 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate (CID 175037316) is 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate.
What is the SMILES notation for 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate?
The canonical SMILES for 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate is CCOP(=O)(O)O.Cc1cnc(C)[nH]1.
What is the InChIKey of 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate?
The InChIKey is ISOHLLYMOBRJIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.C2H7O4P/c1-4-3-6-5(2)7-4;1-2-6-7(3,4)5/h3H,1-2H3,(H,6,7);2H2,1H3,(H2,3,4,5).
What are the key properties of 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate?
2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate has a molecular weight of 222.18 g/mol, XLogP of 1.14, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1H-imidazole;ethyl dihydrogen phosphate is sourced from PubChem (CID 175037316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).