About 2-hydroperoxyethyl 2-tert-butylhexanoate
2-hydroperoxyethyl 2-tert-butylhexanoate (PubChem CID 175037363) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-hydroperoxyethyl 2-tert-butylhexanoate.
Molecular Properties
| Compound Name | 2-hydroperoxyethyl 2-tert-butylhexanoate |
| PubChem CID | 175037363 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-hydroperoxyethyl 2-tert-butylhexanoate |
| SMILES | CCCCC(C(=O)OCCOO)C(C)(C)C |
| InChI | InChI=1S/C12H24O4/c1-5-6-7-10(12(2,3)4)11(13)15-8-9-16-14/h10,14H,5-9H2,1-4H3 |
| InChIKey | NQEWHCNENOTDMB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroperoxyethyl 2-tert-butylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroperoxyethyl 2-tert-butylhexanoate?
The IUPAC name of 2-hydroperoxyethyl 2-tert-butylhexanoate (CID 175037363) is 2-hydroperoxyethyl 2-tert-butylhexanoate.
What is the SMILES notation for 2-hydroperoxyethyl 2-tert-butylhexanoate?
The canonical SMILES for 2-hydroperoxyethyl 2-tert-butylhexanoate is CCCCC(C(=O)OCCOO)C(C)(C)C.
What is the InChIKey of 2-hydroperoxyethyl 2-tert-butylhexanoate?
The InChIKey is NQEWHCNENOTDMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4/c1-5-6-7-10(12(2,3)4)11(13)15-8-9-16-14/h10,14H,5-9H2,1-4H3.
What are the key properties of 2-hydroperoxyethyl 2-tert-butylhexanoate?
2-hydroperoxyethyl 2-tert-butylhexanoate has a molecular weight of 232.32 g/mol, XLogP of 2.87, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroperoxyethyl 2-tert-butylhexanoate is sourced from PubChem (CID 175037363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).