C17H21ClN2OS — CID 175037680
4-[[4-[4-(chloromethyl)-5-methyl-1,3-thiazol-2-yl]phenyl]methyl]-3-methylmorpholine (PubChem CID 175037680) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is 4-[[4-[4-(chloromethyl)-5-methyl-1,3-thiazol-2-yl]phenyl]methyl]-3-methylmorpholine.
| Compound Name | 4-[[4-[4-(chloromethyl)-5-methyl-1,3-thiazol-2-yl]phenyl]methyl]-3-methylmorpholine |
|---|---|
| PubChem CID | 175037680 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-[[4-[4-(chloromethyl)-5-methyl-1,3-thiazol-2-yl]phenyl]methyl]-3-methylmorpholine |
| SMILES | Cc1sc(-c2ccc(CN3CCOCC3C)cc2)nc1CCl |
| InChI | InChI=1S/C17H21ClN2OS/c1-12-11-21-8-7-20(12)10-14-3-5-15(6-4-14)17-19-16(9-18)13(2)22-17/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | CWZGFEUMTDZQDJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|