About 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide
2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide (PubChem CID 175037818) has the molecular formula C11H18N6O
and a molecular weight of 250.31 g/mol. Its IUPAC name is 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide.
Molecular Properties
| Compound Name | 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide |
| PubChem CID | 175037818 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide |
| SMILES | CCCCN1C=CN(CC(N)=O)C1.N#CNC#N |
| InChI | InChI=1S/C9H17N3O.C2HN3/c1-2-3-4-11-5-6-12(8-11)7-9(10)13;3-1-5-2-4/h5-6H,2-4,7-8H2,1H3,(H2,10,13);5H |
| InChIKey | UPMFFBCXMSQJLG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide?
The IUPAC name of 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide (CID 175037818) is 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide.
What is the SMILES notation for 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide?
The canonical SMILES for 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide is CCCCN1C=CN(CC(N)=O)C1.N#CNC#N.
What is the InChIKey of 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide?
The InChIKey is UPMFFBCXMSQJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O.C2HN3/c1-2-3-4-11-5-6-12(8-11)7-9(10)13;3-1-5-2-4/h5-6H,2-4,7-8H2,1H3,(H2,10,13);5H.
What are the key properties of 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide?
2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide has a molecular weight of 250.31 g/mol, XLogP of -0.14, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-butyl-2H-imidazol-1-yl)acetamide;cyanocyanamide is sourced from PubChem (CID 175037818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).