C18H22S — CID 175037833
3,4-bis(4-methylphenyl)butane-1-thiol (PubChem CID 175037833) has the molecular formula C18H22S and a molecular weight of 270.44 g/mol. Its IUPAC name is 3,4-bis(4-methylphenyl)butane-1-thiol.
| Compound Name | 3,4-bis(4-methylphenyl)butane-1-thiol |
|---|---|
| PubChem CID | 175037833 |
| Molecular Formula | C18H22S |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3,4-bis(4-methylphenyl)butane-1-thiol |
| SMILES | Cc1ccc(CC(CCS)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H22S/c1-14-3-7-16(8-4-14)13-18(11-12-19)17-9-5-15(2)6-10-17/h3-10,18-19H,11-13H2,1-2H3 |
| InChIKey | DNBYNHNFKVOZJD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|