About 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol
1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol (PubChem CID 175038311) has the molecular formula C14H21BrO2
and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol.
Molecular Properties
| Compound Name | 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol |
| PubChem CID | 175038311 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol |
| SMILES | C=Cc1ccccc1Br.CC(C)(O)C(C)(C)O |
| InChI | InChI=1S/C8H7Br.C6H14O2/c1-2-7-5-3-4-6-8(7)9;1-5(2,7)6(3,4)8/h2-6H,1H2;7-8H,1-4H3 |
| InChIKey | GSKZPGXPVXUJEG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol?
The IUPAC name of 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol (CID 175038311) is 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol.
What is the SMILES notation for 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol?
The canonical SMILES for 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol is C=Cc1ccccc1Br.CC(C)(O)C(C)(C)O.
What is the InChIKey of 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol?
The InChIKey is GSKZPGXPVXUJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br.C6H14O2/c1-2-7-5-3-4-6-8(7)9;1-5(2,7)6(3,4)8/h2-6H,1H2;7-8H,1-4H3.
What are the key properties of 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol?
1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol has a molecular weight of 301.22 g/mol, XLogP of 3.62, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-ethenylbenzene;2,3-dimethylbutane-2,3-diol is sourced from PubChem (CID 175038311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).