C17H20N4O3S — CID 175038553
4-[5-[4-(N-methyl-C-methylsulfanylcarbonimidoyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidine-1-carboxylic acid (PubChem CID 175038553) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-[5-[4-(N-methyl-C-methylsulfanylcarbonimidoyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[5-[4-(N-methyl-C-methylsulfanylcarbonimidoyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175038553 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-[5-[4-(N-methyl-C-methylsulfanylcarbonimidoyl)phenyl]-1,3,4-oxadiazol-2-yl]piperidine-1-carboxylic acid |
| SMILES | C/N=C(\SC)c1ccc(-c2nnc(C3CCN(C(=O)O)CC3)o2)cc1 |
| InChI | InChI=1S/C17H20N4O3S/c1-18-16(25-2)13-5-3-11(4-6-13)14-19-20-15(24-14)12-7-9-21(10-8-12)17(22)23/h3-6,12H,7-10H2,1-2H3,(H,22,23)/b18-16- |
| InChIKey | MDCLBSMUMPNRCW-VLGSPTGOSA-N |
| XLogP | 3.33 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|