C5H14NO5P — CID 175038682
N-(hydroxymethyl)propanamide;methylphosphonic acid (PubChem CID 175038682) has the molecular formula C5H14NO5P and a molecular weight of 199.14 g/mol. Its IUPAC name is N-(hydroxymethyl)propanamide;methylphosphonic acid.
| Compound Name | N-(hydroxymethyl)propanamide;methylphosphonic acid |
|---|---|
| PubChem CID | 175038682 |
| Molecular Formula | C5H14NO5P |
| Molecular Weight | 199.14 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-(hydroxymethyl)propanamide;methylphosphonic acid |
| SMILES | CCC(=O)NCO.CP(=O)(O)O |
| InChI | InChI=1S/C4H9NO2.CH5O3P/c1-2-4(7)5-3-6;1-5(2,3)4/h6H,2-3H2,1H3,(H,5,7);1H3,(H2,2,3,4) |
| InChIKey | JINHTQIYJQWHIL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.14 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|