C22H38O7 — CID 175039326
6-[(4-nonoxyphenyl)methoxy]hexane-1,2,3,4,5-pentol (PubChem CID 175039326) has the molecular formula C22H38O7 and a molecular weight of 414.54 g/mol. Its IUPAC name is 6-[(4-nonoxyphenyl)methoxy]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[(4-nonoxyphenyl)methoxy]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 175039326 |
| Molecular Formula | C22H38O7 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 6-[(4-nonoxyphenyl)methoxy]hexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCCCCOc1ccc(COCC(O)C(O)C(O)C(O)CO)cc1 |
| InChI | InChI=1S/C22H38O7/c1-2-3-4-5-6-7-8-13-29-18-11-9-17(10-12-18)15-28-16-20(25)22(27)21(26)19(24)14-23/h9-12,19-27H,2-8,13-16H2,1H3 |
| InChIKey | CVJKNXHSHFPIKT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|