C25H34O4 — CID 175040335
[2-(4-methoxyphenyl)-2-phenylmethoxypropyl] octanoate (PubChem CID 175040335) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-phenylmethoxypropyl] octanoate.
| Compound Name | [2-(4-methoxyphenyl)-2-phenylmethoxypropyl] octanoate |
|---|---|
| PubChem CID | 175040335 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-phenylmethoxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(C)(OCc1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H34O4/c1-4-5-6-7-11-14-24(26)28-20-25(2,22-15-17-23(27-3)18-16-22)29-19-21-12-9-8-10-13-21/h8-10,12-13,15-18H,4-7,11,14,19-20H2,1-3H3 |
| InChIKey | JUIREEMJPFEAOV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|