About (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride
(2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride (PubChem CID 175042013) has the molecular formula C7H12Cl2SiTi
and a molecular weight of 243.03 g/mol. Its IUPAC name is (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride.
Molecular Properties
| Compound Name | (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride |
| PubChem CID | 175042013 |
| Molecular Formula | C7H12Cl2SiTi |
| Molecular Weight | 243.03 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride |
| SMILES | CC1=CC([SiH3])=C(C)C1.[Cl-].[Cl-].[Ti+2] |
| InChI | InChI=1S/C7H12Si.2ClH.Ti/c1-5-3-6(2)7(8)4-5;;;/h4H,3H2,1-2,8H3;2*1H;/q;;;+2/p-2 |
| InChIKey | HTWPFPOUQQTMAP-UHFFFAOYSA-L |
| XLogP | -5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.03 |
| LogP ≤ 5 | -5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride?
The IUPAC name of (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride (CID 175042013) is (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride.
What is the SMILES notation for (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride?
The canonical SMILES for (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride is CC1=CC([SiH3])=C(C)C1.[Cl-].[Cl-].[Ti+2].
What is the InChIKey of (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride?
The InChIKey is HTWPFPOUQQTMAP-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H12Si.2ClH.Ti/c1-5-3-6(2)7(8)4-5;;;/h4H,3H2,1-2,8H3;2*1H;/q;;;+2/p-2.
What are the key properties of (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride?
(2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride has a molecular weight of 243.03 g/mol, XLogP of -5.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylcyclopenta-1,4-dien-1-yl)silane;titanium(2+);dichloride is sourced from PubChem (CID 175042013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).