About 1-(1,2,2-trifluoroethyl)piperazin-2-one
1-(1,2,2-trifluoroethyl)piperazin-2-one (PubChem CID 175042223) has the molecular formula C6H9F3N2O
and a molecular weight of 182.14 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethyl)piperazin-2-one.
Molecular Properties
| Compound Name | 1-(1,2,2-trifluoroethyl)piperazin-2-one |
| PubChem CID | 175042223 |
| Molecular Formula | C6H9F3N2O |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1-(1,2,2-trifluoroethyl)piperazin-2-one |
| SMILES | O=C1CNCCN1C(F)C(F)F |
| InChI | InChI=1S/C6H9F3N2O/c7-5(8)6(9)11-2-1-10-3-4(11)12/h5-6,10H,1-3H2 |
| InChIKey | HYMVCOGTCLWNJU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2,2-trifluoroethyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,2-trifluoroethyl)piperazin-2-one?
The IUPAC name of 1-(1,2,2-trifluoroethyl)piperazin-2-one (CID 175042223) is 1-(1,2,2-trifluoroethyl)piperazin-2-one.
What is the SMILES notation for 1-(1,2,2-trifluoroethyl)piperazin-2-one?
The canonical SMILES for 1-(1,2,2-trifluoroethyl)piperazin-2-one is O=C1CNCCN1C(F)C(F)F.
What is the InChIKey of 1-(1,2,2-trifluoroethyl)piperazin-2-one?
The InChIKey is HYMVCOGTCLWNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3N2O/c7-5(8)6(9)11-2-1-10-3-4(11)12/h5-6,10H,1-3H2.
What are the key properties of 1-(1,2,2-trifluoroethyl)piperazin-2-one?
1-(1,2,2-trifluoroethyl)piperazin-2-one has a molecular weight of 182.14 g/mol, XLogP of -0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,2-trifluoroethyl)piperazin-2-one is sourced from PubChem (CID 175042223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).