About methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene
methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene (PubChem CID 175042291) has the molecular formula C4H12N8Po
and a molecular weight of 381.20 g/mol. Its IUPAC name is methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene.
Molecular Properties
| Compound Name | methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene |
| PubChem CID | 175042291 |
| Molecular Formula | C4H12N8Po |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene |
| SMILES | C/N=N/[Po](/N=N/C)(/N=N/C)/N=N/C |
| InChI | InChI=1S/4CH3N2.Po/c4*1-3-2;/h4*1H3;/q4*-1;+4 |
| InChIKey | SGOLIBIJHGCELZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 98.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene?
The IUPAC name of methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene (CID 175042291) is methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene.
What is the SMILES notation for methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene?
The canonical SMILES for methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene is C/N=N/[Po](/N=N/C)(/N=N/C)/N=N/C.
What is the InChIKey of methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene?
The InChIKey is SGOLIBIJHGCELZ-UHFFFAOYSA-N. The full InChI is InChI=1S/4CH3N2.Po/c4*1-3-2;/h4*1H3;/q4*-1;+4.
What are the key properties of methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene?
methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene has a molecular weight of 381.20 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[tris(methyldiazenyl)-λ4-polanyl]diazene is sourced from PubChem (CID 175042291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).