C17H23N7O4S — CID 175042394
2-[1-[2-(pyridin-4-ylamino)pyrimidin-4-yl]piperidin-4-yl]ethylsulfamoyl carbamate (PubChem CID 175042394) has the molecular formula C17H23N7O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-[1-[2-(pyridin-4-ylamino)pyrimidin-4-yl]piperidin-4-yl]ethylsulfamoyl carbamate.
| Compound Name | 2-[1-[2-(pyridin-4-ylamino)pyrimidin-4-yl]piperidin-4-yl]ethylsulfamoyl carbamate |
|---|---|
| PubChem CID | 175042394 |
| Molecular Formula | C17H23N7O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-[1-[2-(pyridin-4-ylamino)pyrimidin-4-yl]piperidin-4-yl]ethylsulfamoyl carbamate |
| SMILES | NC(=O)OS(=O)(=O)NCCC1CCN(c2ccnc(Nc3ccncc3)n2)CC1 |
| InChI | InChI=1S/C17H23N7O4S/c18-16(25)28-29(26,27)21-10-1-13-5-11-24(12-6-13)15-4-9-20-17(23-15)22-14-2-7-19-8-3-14/h2-4,7-9,13,21H,1,5-6,10-12H2,(H2,18,25)(H,19,20,22,23) |
| InChIKey | DHFOIFDGJMOGBT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 152.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |