C14H14Cl2N2O2 — CID 175042655
2-chloro-N'-hydroxy-3-phenylmethoxybenzenecarboximidamide;hydrochloride (PubChem CID 175042655) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-3-phenylmethoxybenzenecarboximidamide;hydrochloride.
| Compound Name | 2-chloro-N'-hydroxy-3-phenylmethoxybenzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 175042655 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-chloro-N'-hydroxy-3-phenylmethoxybenzenecarboximidamide;hydrochloride |
| SMILES | Cl.NC(=NO)c1cccc(OCc2ccccc2)c1Cl |
| InChI | InChI=1S/C14H13ClN2O2.ClH/c15-13-11(14(16)17-18)7-4-8-12(13)19-9-10-5-2-1-3-6-10;/h1-8,18H,9H2,(H2,16,17);1H |
| InChIKey | QNKFDRBGLLDHPZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|