C8H5F5O3S — CID 175042940
1-ethenyl-2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 175042940) has the molecular formula C8H5F5O3S and a molecular weight of 276.18 g/mol. Its IUPAC name is 1-ethenyl-2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 1-ethenyl-2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 175042940 |
| Molecular Formula | C8H5F5O3S |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 1-ethenyl-2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | C=CC1(S(=O)(=O)O)C(F)=C(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C8H5F5O3S/c1-2-8(17(14,15)16)6(12)4(10)3(9)5(11)7(8)13/h2,6H,1H2,(H,14,15,16) |
| InChIKey | NEBWIEOURYCNDE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|