About 3-(chloromethyl)-1,8-naphthyridine
3-(chloromethyl)-1,8-naphthyridine (PubChem CID 175043064) has the molecular formula C9H7ClN2
and a molecular weight of 178.62 g/mol. Its IUPAC name is 3-(chloromethyl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 3-(chloromethyl)-1,8-naphthyridine |
| PubChem CID | 175043064 |
| Molecular Formula | C9H7ClN2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 3-(chloromethyl)-1,8-naphthyridine |
| SMILES | ClCc1cnc2ncccc2c1 |
| InChI | InChI=1S/C9H7ClN2/c10-5-7-4-8-2-1-3-11-9(8)12-6-7/h1-4,6H,5H2 |
| InChIKey | DCWSZDHMZFRNQF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-1,8-naphthyridine?
The IUPAC name of 3-(chloromethyl)-1,8-naphthyridine (CID 175043064) is 3-(chloromethyl)-1,8-naphthyridine.
What is the SMILES notation for 3-(chloromethyl)-1,8-naphthyridine?
The canonical SMILES for 3-(chloromethyl)-1,8-naphthyridine is ClCc1cnc2ncccc2c1.
What is the InChIKey of 3-(chloromethyl)-1,8-naphthyridine?
The InChIKey is DCWSZDHMZFRNQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2/c10-5-7-4-8-2-1-3-11-9(8)12-6-7/h1-4,6H,5H2.
What are the key properties of 3-(chloromethyl)-1,8-naphthyridine?
3-(chloromethyl)-1,8-naphthyridine has a molecular weight of 178.62 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-1,8-naphthyridine is sourced from PubChem (CID 175043064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).