C20H22O3 — CID 175043499
3-[4-[[4-(hydroxymethyl)phenyl]methyl]phenyl]hex-4-enoic acid (PubChem CID 175043499) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is 3-[4-[[4-(hydroxymethyl)phenyl]methyl]phenyl]hex-4-enoic acid.
| Compound Name | 3-[4-[[4-(hydroxymethyl)phenyl]methyl]phenyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 175043499 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-[4-[[4-(hydroxymethyl)phenyl]methyl]phenyl]hex-4-enoic acid |
| SMILES | CC=CC(CC(=O)O)c1ccc(Cc2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C20H22O3/c1-2-3-19(13-20(22)23)18-10-8-16(9-11-18)12-15-4-6-17(14-21)7-5-15/h2-11,19,21H,12-14H2,1H3,(H,22,23) |
| InChIKey | HUSCKVYRFIHRAP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|