About N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride
N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride (PubChem CID 175043924) has the molecular formula C8H14ClF3N2O
and a molecular weight of 246.66 g/mol. Its IUPAC name is N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride.
Molecular Properties
| Compound Name | N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride |
| PubChem CID | 175043924 |
| Molecular Formula | C8H14ClF3N2O |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride |
| SMILES | Cl.O=CNC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H13F3N2O.ClH/c9-8(10,11)5-13-3-1-7(2-4-13)12-6-14;/h6-7H,1-5H2,(H,12,14);1H |
| InChIKey | VZBJAACMNJSFEG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride?
The IUPAC name of N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride (CID 175043924) is N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride.
What is the SMILES notation for N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride?
The canonical SMILES for N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride is Cl.O=CNC1CCN(CC(F)(F)F)CC1.
What is the InChIKey of N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride?
The InChIKey is VZBJAACMNJSFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O.ClH/c9-8(10,11)5-13-3-1-7(2-4-13)12-6-14;/h6-7H,1-5H2,(H,12,14);1H.
What are the key properties of N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride?
N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride has a molecular weight of 246.66 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]formamide;hydrochloride is sourced from PubChem (CID 175043924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).