C23H25NO5 — CID 175044137
3-[[(2R,6S)-2,6-dimethylmorpholin-2-yl]methyl]-1,8-dimethoxyanthracene-9,10-dione (PubChem CID 175044137) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-[[(2R,6S)-2,6-dimethylmorpholin-2-yl]methyl]-1,8-dimethoxyanthracene-9,10-dione.
| Compound Name | 3-[[(2R,6S)-2,6-dimethylmorpholin-2-yl]methyl]-1,8-dimethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 175044137 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-[[(2R,6S)-2,6-dimethylmorpholin-2-yl]methyl]-1,8-dimethoxyanthracene-9,10-dione |
| SMILES | COc1cccc2c1C(=O)c1c(OC)cc(C[C@]3(C)CNC[C@H](C)O3)cc1C2=O |
| InChI | InChI=1S/C23H25NO5/c1-13-11-24-12-23(2,29-13)10-14-8-16-20(18(9-14)28-4)22(26)19-15(21(16)25)6-5-7-17(19)27-3/h5-9,13,24H,10-12H2,1-4H3/t13-,23+/m0/s1 |
| InChIKey | DPQAARZKJLRQFX-ZAMGYDSWSA-N |
| XLogP | 2.79 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|