C14H9BrFN5O5S — CID 175044452
2-[[4-[4-(3-bromo-4-fluorophenyl)-5-(oxomethylidene)-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl carbamate (PubChem CID 175044452) has the molecular formula C14H9BrFN5O5S and a molecular weight of 458.23 g/mol. Its IUPAC name is 2-[[4-[4-(3-bromo-4-fluorophenyl)-5-(oxomethylidene)-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl carbamate.
| Compound Name | 2-[[4-[4-(3-bromo-4-fluorophenyl)-5-(oxomethylidene)-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl carbamate |
|---|---|
| PubChem CID | 175044452 |
| Molecular Formula | C14H9BrFN5O5S |
| Molecular Weight | 458.23 g/mol |
| Exact Mass | 456.95 |
| IUPAC Name | 2-[[4-[4-(3-bromo-4-fluorophenyl)-5-(oxomethylidene)-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl carbamate |
| SMILES | NC(=O)OCCSc1nonc1C1=NOC(=C=O)N1c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H9BrFN5O5S/c15-8-5-7(1-2-9(8)16)21-10(6-22)25-19-12(21)11-13(20-26-18-11)27-4-3-24-14(17)23/h1-2,5H,3-4H2,(H2,17,23) |
| InChIKey | QYSHTXWWHBRPEI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|