C30H39FN2O3 — CID 175044703
N-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpent-2-enamide (PubChem CID 175044703) has the molecular formula C30H39FN2O3 and a molecular weight of 494.65 g/mol. Its IUPAC name is N-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpent-2-enamide.
| Compound Name | N-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpent-2-enamide |
|---|---|
| PubChem CID | 175044703 |
| Molecular Formula | C30H39FN2O3 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | N-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpent-2-enamide |
| SMILES | C=C1CCC2C(C(C)CC(O)C2(C)C)C1CCC(C)=CC(=O)NCc1cc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C30H39FN2O3/c1-18(6-12-24-19(2)7-13-25-29(24)20(3)15-27(34)30(25,4)5)14-28(35)32-17-23-16-26(33-36-23)21-8-10-22(31)11-9-21/h8-11,14,16,20,24-25,27,29,34H,2,6-7,12-13,15,17H2,1,3-5H3,(H,32,35) |
| InChIKey | MICGQCXBKSLFKP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|