C6H10NNaO3S4 — CID 175044931
sodium 2-(4,5-dihydro-1,3-thiazol-2-yl)-3,3-bis(sulfanyl)propane-1-sulfonate (PubChem CID 175044931) has the molecular formula C6H10NNaO3S4 and a molecular weight of 295.41 g/mol. Its IUPAC name is sodium 2-(4,5-dihydro-1,3-thiazol-2-yl)-3,3-bis(sulfanyl)propane-1-sulfonate.
| Compound Name | sodium 2-(4,5-dihydro-1,3-thiazol-2-yl)-3,3-bis(sulfanyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 175044931 |
| Molecular Formula | C6H10NNaO3S4 |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 294.94 |
| IUPAC Name | sodium 2-(4,5-dihydro-1,3-thiazol-2-yl)-3,3-bis(sulfanyl)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(C1=NCCS1)C(S)S.[Na+] |
| InChI | InChI=1S/C6H11NO3S4.Na/c8-14(9,10)3-4(6(11)12)5-7-1-2-13-5;/h4,6,11-12H,1-3H2,(H,8,9,10);/q;+1/p-1 |
| InChIKey | GMAKNNWLGYMBLU-UHFFFAOYSA-M |
| XLogP | -2.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|