C12H16BNO3 — CID 175044938
N,5,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-amine (PubChem CID 175044938) has the molecular formula C12H16BNO3 and a molecular weight of 233.08 g/mol. Its IUPAC name is N,5,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-amine.
| Compound Name | N,5,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-amine |
|---|---|
| PubChem CID | 175044938 |
| Molecular Formula | C12H16BNO3 |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N,5,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-amine |
| SMILES | CNC1OB2OC(C)COc3ccc(C)c1c32 |
| InChI | InChI=1S/C12H16BNO3/c1-7-4-5-9-11-10(7)12(14-3)17-13(11)16-8(2)6-15-9/h4-5,8,12,14H,6H2,1-3H3 |
| InChIKey | DYYFKQAMEKVWMI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|