About bis(4,5-dihydro-1,3-oxazole);1H-imidazole
bis(4,5-dihydro-1,3-oxazole);1H-imidazole (PubChem CID 175045233) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is bis(4,5-dihydro-1,3-oxazole);1H-imidazole.
Molecular Properties
| Compound Name | bis(4,5-dihydro-1,3-oxazole);1H-imidazole |
| PubChem CID | 175045233 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | bis(4,5-dihydro-1,3-oxazole);1H-imidazole |
| SMILES | C1=NCCO1.C1=NCCO1.c1c[nH]cn1 |
| InChI | InChI=1S/C3H4N2.2C3H5NO/c3*1-2-5-3-4-1/h1-3H,(H,4,5);2*3H,1-2H2 |
| InChIKey | GXVGEPGQWCVDLQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(4,5-dihydro-1,3-oxazole);1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4,5-dihydro-1,3-oxazole);1H-imidazole?
The IUPAC name of bis(4,5-dihydro-1,3-oxazole);1H-imidazole (CID 175045233) is bis(4,5-dihydro-1,3-oxazole);1H-imidazole.
What is the SMILES notation for bis(4,5-dihydro-1,3-oxazole);1H-imidazole?
The canonical SMILES for bis(4,5-dihydro-1,3-oxazole);1H-imidazole is C1=NCCO1.C1=NCCO1.c1c[nH]cn1.
What is the InChIKey of bis(4,5-dihydro-1,3-oxazole);1H-imidazole?
The InChIKey is GXVGEPGQWCVDLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.2C3H5NO/c3*1-2-5-3-4-1/h1-3H,(H,4,5);2*3H,1-2H2.
What are the key properties of bis(4,5-dihydro-1,3-oxazole);1H-imidazole?
bis(4,5-dihydro-1,3-oxazole);1H-imidazole has a molecular weight of 210.24 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4,5-dihydro-1,3-oxazole);1H-imidazole is sourced from PubChem (CID 175045233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).