About 4-bromopyridine;4,5-diphenyltriazine
4-bromopyridine;4,5-diphenyltriazine (PubChem CID 175045379) has the molecular formula C20H15BrN4
and a molecular weight of 391.27 g/mol. Its IUPAC name is 4-bromopyridine;4,5-diphenyltriazine.
Molecular Properties
| Compound Name | 4-bromopyridine;4,5-diphenyltriazine |
| PubChem CID | 175045379 |
| Molecular Formula | C20H15BrN4 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4-bromopyridine;4,5-diphenyltriazine |
| SMILES | Brc1ccncc1.c1ccc(-c2cnnnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H11N3.C5H4BrN/c1-3-7-12(8-4-1)14-11-16-18-17-15(14)13-9-5-2-6-10-13;6-5-1-3-7-4-2-5/h1-11H;1-4H |
| InChIKey | AJQVUDHAPKXMPW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromopyridine;4,5-diphenyltriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromopyridine;4,5-diphenyltriazine?
The IUPAC name of 4-bromopyridine;4,5-diphenyltriazine (CID 175045379) is 4-bromopyridine;4,5-diphenyltriazine.
What is the SMILES notation for 4-bromopyridine;4,5-diphenyltriazine?
The canonical SMILES for 4-bromopyridine;4,5-diphenyltriazine is Brc1ccncc1.c1ccc(-c2cnnnc2-c2ccccc2)cc1.
What is the InChIKey of 4-bromopyridine;4,5-diphenyltriazine?
The InChIKey is AJQVUDHAPKXMPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3.C5H4BrN/c1-3-7-12(8-4-1)14-11-16-18-17-15(14)13-9-5-2-6-10-13;6-5-1-3-7-4-2-5/h1-11H;1-4H.
What are the key properties of 4-bromopyridine;4,5-diphenyltriazine?
4-bromopyridine;4,5-diphenyltriazine has a molecular weight of 391.27 g/mol, XLogP of 5.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromopyridine;4,5-diphenyltriazine is sourced from PubChem (CID 175045379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).