About 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride
4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride (PubChem CID 175046040) has the molecular formula C7H14ClN3O2S
and a molecular weight of 239.73 g/mol. Its IUPAC name is 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride |
| PubChem CID | 175046040 |
| Molecular Formula | C7H14ClN3O2S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride |
| SMILES | Cl.NCC1(N)C=CC(S(N)(=O)=O)=CC1 |
| InChI | InChI=1S/C7H13N3O2S.ClH/c8-5-7(9)3-1-6(2-4-7)13(10,11)12;/h1-3H,4-5,8-9H2,(H2,10,11,12);1H |
| InChIKey | NIEJNFPVLNZFHF-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride?
The IUPAC name of 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride (CID 175046040) is 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride.
What is the SMILES notation for 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride?
The canonical SMILES for 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride is Cl.NCC1(N)C=CC(S(N)(=O)=O)=CC1.
What is the InChIKey of 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride?
The InChIKey is NIEJNFPVLNZFHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2S.ClH/c8-5-7(9)3-1-6(2-4-7)13(10,11)12;/h1-3H,4-5,8-9H2,(H2,10,11,12);1H.
What are the key properties of 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride?
4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride has a molecular weight of 239.73 g/mol, XLogP of -0.80, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-(aminomethyl)cyclohexa-1,5-diene-1-sulfonamide;hydrochloride is sourced from PubChem (CID 175046040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).