About 1H-pyrrole;1,3,5-trimethylbenzene
1H-pyrrole;1,3,5-trimethylbenzene (PubChem CID 175046284) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 1H-pyrrole;1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 1H-pyrrole;1,3,5-trimethylbenzene |
| PubChem CID | 175046284 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1H-pyrrole;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.c1cc[nH]c1 |
| InChI | InChI=1S/C9H12.C4H5N/c1-7-4-8(2)6-9(3)5-7;1-2-4-5-3-1/h4-6H,1-3H3;1-5H |
| InChIKey | QHKSIROGIYPSPE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-pyrrole;1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole;1,3,5-trimethylbenzene?
The IUPAC name of 1H-pyrrole;1,3,5-trimethylbenzene (CID 175046284) is 1H-pyrrole;1,3,5-trimethylbenzene.
What is the SMILES notation for 1H-pyrrole;1,3,5-trimethylbenzene?
The canonical SMILES for 1H-pyrrole;1,3,5-trimethylbenzene is Cc1cc(C)cc(C)c1.c1cc[nH]c1.
What is the InChIKey of 1H-pyrrole;1,3,5-trimethylbenzene?
The InChIKey is QHKSIROGIYPSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C4H5N/c1-7-4-8(2)6-9(3)5-7;1-2-4-5-3-1/h4-6H,1-3H3;1-5H.
What are the key properties of 1H-pyrrole;1,3,5-trimethylbenzene?
1H-pyrrole;1,3,5-trimethylbenzene has a molecular weight of 187.29 g/mol, XLogP of 3.63, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole;1,3,5-trimethylbenzene is sourced from PubChem (CID 175046284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).