C21H46ClN — CID 175046684
N,N-dimethylnonadecan-2-amine;hydrochloride (PubChem CID 175046684) has the molecular formula C21H46ClN and a molecular weight of 348.06 g/mol. Its IUPAC name is N,N-dimethylnonadecan-2-amine;hydrochloride.
| Compound Name | N,N-dimethylnonadecan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 175046684 |
| Molecular Formula | C21H46ClN |
| Molecular Weight | 348.06 g/mol |
| Exact Mass | 347.33 |
| IUPAC Name | N,N-dimethylnonadecan-2-amine;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCCC(C)N(C)C.Cl |
| InChI | InChI=1S/C21H45N.ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22(3)4;/h21H,5-20H2,1-4H3;1H |
| InChIKey | MWBNOHZQAFPMFU-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.06 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|