C4H12O11P4 — CID 175047047
oxido-oxo-(1,2,4-triphosphonobutan-2-yl)phosphanium (PubChem CID 175047047) has the molecular formula C4H12O11P4 and a molecular weight of 360.03 g/mol. Its IUPAC name is oxido-oxo-(1,2,4-triphosphonobutan-2-yl)phosphanium.
| Compound Name | oxido-oxo-(1,2,4-triphosphonobutan-2-yl)phosphanium |
|---|---|
| PubChem CID | 175047047 |
| Molecular Formula | C4H12O11P4 |
| Molecular Weight | 360.03 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | oxido-oxo-(1,2,4-triphosphonobutan-2-yl)phosphanium |
| SMILES | O=[P+]([O-])C(CCP(=O)(O)O)(CP(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C4H12O11P4/c5-16(6)4(19(13,14)15,3-18(10,11)12)1-2-17(7,8)9/h1-3H2,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15) |
| InChIKey | VSRJETKIKCYXFG-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 212.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.03 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|