C10H10ClNOS — CID 175047550
9-chloro-2,3,4,5-tetrahydro-1,4-benzothiazepine-5-carbaldehyde (PubChem CID 175047550) has the molecular formula C10H10ClNOS and a molecular weight of 227.72 g/mol. Its IUPAC name is 9-chloro-2,3,4,5-tetrahydro-1,4-benzothiazepine-5-carbaldehyde.
| Compound Name | 9-chloro-2,3,4,5-tetrahydro-1,4-benzothiazepine-5-carbaldehyde |
|---|---|
| PubChem CID | 175047550 |
| Molecular Formula | C10H10ClNOS |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 9-chloro-2,3,4,5-tetrahydro-1,4-benzothiazepine-5-carbaldehyde |
| SMILES | O=CC1NCCSc2c(Cl)cccc21 |
| InChI | InChI=1S/C10H10ClNOS/c11-8-3-1-2-7-9(6-13)12-4-5-14-10(7)8/h1-3,6,9,12H,4-5H2 |
| InChIKey | RYNSSNGGUFMYMH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|