About 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one
2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one (PubChem CID 175047820) has the molecular formula C16H26O6Si
and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one.
Molecular Properties
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one |
| PubChem CID | 175047820 |
| Molecular Formula | C16H26O6Si |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=CC(=O)CO1.O=C1C=CC(O)OC1 |
| InChI | InChI=1S/C11H20O3Si.C5H6O3/c1-11(2,3)15(4,5)14-10-7-6-9(12)8-13-10;6-4-1-2-5(7)8-3-4/h6-7,10H,8H2,1-5H3;1-2,5,7H,3H2 |
| InChIKey | UORVTBSIVCRORU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one?
The IUPAC name of 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one (CID 175047820) is 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one.
What is the SMILES notation for 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one?
The canonical SMILES for 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one is CC(C)(C)[Si](C)(C)OC1C=CC(=O)CO1.O=C1C=CC(O)OC1.
What is the InChIKey of 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one?
The InChIKey is UORVTBSIVCRORU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3Si.C5H6O3/c1-11(2,3)15(4,5)14-10-7-6-9(12)8-13-10;6-4-1-2-5(7)8-3-4/h6-7,10H,8H2,1-5H3;1-2,5,7H,3H2.
What are the key properties of 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one?
2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one has a molecular weight of 342.46 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[tert-butyl(dimethyl)silyl]oxy-2H-pyran-5-one;2-hydroxy-2H-pyran-5-one is sourced from PubChem (CID 175047820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).