About 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide
2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide (PubChem CID 175047928) has the molecular formula C17H33F3N2O
and a molecular weight of 338.46 g/mol. Its IUPAC name is 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide.
Molecular Properties
| Compound Name | 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide |
| PubChem CID | 175047928 |
| Molecular Formula | C17H33F3N2O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide |
| SMILES | CCCCCCC(CCC)CC(CC)(NCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C17H33F3N2O/c1-4-7-8-9-11-14(10-5-2)12-16(6-3,15(21)23)22-13-17(18,19)20/h14,22H,4-13H2,1-3H3,(H2,21,23) |
| InChIKey | DOXKHCSCGADQSZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide?
The IUPAC name of 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide (CID 175047928) is 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide.
What is the SMILES notation for 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide?
The canonical SMILES for 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide is CCCCCCC(CCC)CC(CC)(NCC(F)(F)F)C(N)=O.
What is the InChIKey of 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide?
The InChIKey is DOXKHCSCGADQSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33F3N2O/c1-4-7-8-9-11-14(10-5-2)12-16(6-3,15(21)23)22-13-17(18,19)20/h14,22H,4-13H2,1-3H3,(H2,21,23).
What are the key properties of 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide?
2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide has a molecular weight of 338.46 g/mol, XLogP of 4.55, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-propyl-2-(2,2,2-trifluoroethylamino)decanamide is sourced from PubChem (CID 175047928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).