C23H23NO6 — CID 175049005
(3R)-1-[(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 175049005) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is (3R)-1-[(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 175049005 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (3R)-1-[(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | COc1cccc2c1C(=O)c1c(OC)cc(CN3CCC[C@@H](C(=O)O)C3)cc1C2=O |
| InChI | InChI=1S/C23H23NO6/c1-29-17-7-3-6-15-19(17)22(26)20-16(21(15)25)9-13(10-18(20)30-2)11-24-8-4-5-14(12-24)23(27)28/h3,6-7,9-10,14H,4-5,8,11-12H2,1-2H3,(H,27,28)/t14-/m1/s1 |
| InChIKey | YIDLTKNZDYCRJR-CQSZACIVSA-N |
| XLogP | 2.78 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|