C11H26N4O2 — CID 175049010
1,3-diaminourea;1-methoxy-1-propylcyclohexane (PubChem CID 175049010) has the molecular formula C11H26N4O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1,3-diaminourea;1-methoxy-1-propylcyclohexane.
| Compound Name | 1,3-diaminourea;1-methoxy-1-propylcyclohexane |
|---|---|
| PubChem CID | 175049010 |
| Molecular Formula | C11H26N4O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1,3-diaminourea;1-methoxy-1-propylcyclohexane |
| SMILES | CCCC1(OC)CCCCC1.NNC(=O)NN |
| InChI | InChI=1S/C10H20O.CH6N4O/c1-3-7-10(11-2)8-5-4-6-9-10;2-4-1(6)5-3/h3-9H2,1-2H3;2-3H2,(H2,4,5,6) |
| InChIKey | HADBOANCWKZSTP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|