C18H20O — CID 175049581
2,3,6,7,10,11-hexahydrotriphenylene;hydrate (PubChem CID 175049581) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is 2,3,6,7,10,11-hexahydrotriphenylene;hydrate.
| Compound Name | 2,3,6,7,10,11-hexahydrotriphenylene;hydrate |
|---|---|
| PubChem CID | 175049581 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2,3,6,7,10,11-hexahydrotriphenylene;hydrate |
| SMILES | C1=c2c3c(c4c(c2=CCC1)=CCCC=4)=CCCC=3.O |
| InChI | InChI=1S/C18H18.H2O/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;/h7-12H,1-6H2;1H2 |
| InChIKey | ZIFPJEBTMNAEBN-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |