About 1-chloronaphthalene;2-methylquinoline
1-chloronaphthalene;2-methylquinoline (PubChem CID 175049880) has the molecular formula C20H16ClN
and a molecular weight of 305.81 g/mol. Its IUPAC name is 1-chloronaphthalene;2-methylquinoline.
Molecular Properties
| Compound Name | 1-chloronaphthalene;2-methylquinoline |
| PubChem CID | 175049880 |
| Molecular Formula | C20H16ClN |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-chloronaphthalene;2-methylquinoline |
| SMILES | Cc1ccc2ccccc2n1.Clc1cccc2ccccc12 |
| InChI | InChI=1S/C10H7Cl.C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-8-6-7-9-4-2-3-5-10(9)11-8/h1-7H;2-7H,1H3 |
| InChIKey | ZTPQSNMBKDTJPR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloronaphthalene;2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloronaphthalene;2-methylquinoline?
The IUPAC name of 1-chloronaphthalene;2-methylquinoline (CID 175049880) is 1-chloronaphthalene;2-methylquinoline.
What is the SMILES notation for 1-chloronaphthalene;2-methylquinoline?
The canonical SMILES for 1-chloronaphthalene;2-methylquinoline is Cc1ccc2ccccc2n1.Clc1cccc2ccccc12.
What is the InChIKey of 1-chloronaphthalene;2-methylquinoline?
The InChIKey is ZTPQSNMBKDTJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl.C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-8-6-7-9-4-2-3-5-10(9)11-8/h1-7H;2-7H,1H3.
What are the key properties of 1-chloronaphthalene;2-methylquinoline?
1-chloronaphthalene;2-methylquinoline has a molecular weight of 305.81 g/mol, XLogP of 6.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloronaphthalene;2-methylquinoline is sourced from PubChem (CID 175049880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).