About 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine
2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine (PubChem CID 175051503) has the molecular formula C21H12Cl2N2O
and a molecular weight of 379.25 g/mol. Its IUPAC name is 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine |
| PubChem CID | 175051503 |
| Molecular Formula | C21H12Cl2N2O |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine |
| SMILES | O=C1C(Cl)=CC(Cl)=c2ccc3c(c21)C=c1ccccc1=3.c1cncnc1 |
| InChI | InChI=1S/C17H8Cl2O.C4H4N2/c18-14-8-15(19)17(20)16-12(14)6-5-11-10-4-2-1-3-9(10)7-13(11)16;1-2-5-4-6-3-1/h1-8H;1-4H |
| InChIKey | KWKYVUHGGRCZMT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine?
The IUPAC name of 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine (CID 175051503) is 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine.
What is the SMILES notation for 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine?
The canonical SMILES for 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine is O=C1C(Cl)=CC(Cl)=c2ccc3c(c21)C=c1ccccc1=3.c1cncnc1.
What is the InChIKey of 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine?
The InChIKey is KWKYVUHGGRCZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8Cl2O.C4H4N2/c18-14-8-15(19)17(20)16-12(14)6-5-11-10-4-2-1-3-9(10)7-13(11)16;1-2-5-4-6-3-1/h1-8H;1-4H.
What are the key properties of 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine?
2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine has a molecular weight of 379.25 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorobenzo[a]fluoren-1-one;pyrimidine is sourced from PubChem (CID 175051503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).