About (3,5-dimethylphenyl)-methylphosphane;hydrochloride
(3,5-dimethylphenyl)-methylphosphane;hydrochloride (PubChem CID 175052086) has the molecular formula C9H14ClP
and a molecular weight of 188.64 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-methylphosphane;hydrochloride.
Molecular Properties
| Compound Name | (3,5-dimethylphenyl)-methylphosphane;hydrochloride |
| PubChem CID | 175052086 |
| Molecular Formula | C9H14ClP |
| Molecular Weight | 188.64 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (3,5-dimethylphenyl)-methylphosphane;hydrochloride |
| SMILES | CPc1cc(C)cc(C)c1.Cl |
| InChI | InChI=1S/C9H13P.ClH/c1-7-4-8(2)6-9(5-7)10-3;/h4-6,10H,1-3H3;1H |
| InChIKey | SMCSGDLRVGAHBC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethylphenyl)-methylphosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylphenyl)-methylphosphane;hydrochloride?
The IUPAC name of (3,5-dimethylphenyl)-methylphosphane;hydrochloride (CID 175052086) is (3,5-dimethylphenyl)-methylphosphane;hydrochloride.
What is the SMILES notation for (3,5-dimethylphenyl)-methylphosphane;hydrochloride?
The canonical SMILES for (3,5-dimethylphenyl)-methylphosphane;hydrochloride is CPc1cc(C)cc(C)c1.Cl.
What is the InChIKey of (3,5-dimethylphenyl)-methylphosphane;hydrochloride?
The InChIKey is SMCSGDLRVGAHBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13P.ClH/c1-7-4-8(2)6-9(5-7)10-3;/h4-6,10H,1-3H3;1H.
What are the key properties of (3,5-dimethylphenyl)-methylphosphane;hydrochloride?
(3,5-dimethylphenyl)-methylphosphane;hydrochloride has a molecular weight of 188.64 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylphenyl)-methylphosphane;hydrochloride is sourced from PubChem (CID 175052086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).