C15H15FN2O4 — CID 175052118
[(1R,3S,4R)-4-(1,3-dioxoisoindol-2-yl)-3-fluorocyclohexyl] carbamate (PubChem CID 175052118) has the molecular formula C15H15FN2O4 and a molecular weight of 306.29 g/mol. Its IUPAC name is [(1R,3S,4R)-4-(1,3-dioxoisoindol-2-yl)-3-fluorocyclohexyl] carbamate.
| Compound Name | [(1R,3S,4R)-4-(1,3-dioxoisoindol-2-yl)-3-fluorocyclohexyl] carbamate |
|---|---|
| PubChem CID | 175052118 |
| Molecular Formula | C15H15FN2O4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [(1R,3S,4R)-4-(1,3-dioxoisoindol-2-yl)-3-fluorocyclohexyl] carbamate |
| SMILES | NC(=O)O[C@@H]1CC[C@@H](N2C(=O)c3ccccc3C2=O)[C@@H](F)C1 |
| InChI | InChI=1S/C15H15FN2O4/c16-11-7-8(22-15(17)21)5-6-12(11)18-13(19)9-3-1-2-4-10(9)14(18)20/h1-4,8,11-12H,5-7H2,(H2,17,21)/t8-,11+,12-/m1/s1 |
| InChIKey | GGABPUSQQIBORH-JFUSQASVSA-N |
| XLogP | 1.64 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|