C16H9F9N2 — CID 175052241
[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-phenyldiazene (PubChem CID 175052241) has the molecular formula C16H9F9N2 and a molecular weight of 400.24 g/mol. Its IUPAC name is [4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-phenyldiazene.
| Compound Name | [4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-phenyldiazene |
|---|---|
| PubChem CID | 175052241 |
| Molecular Formula | C16H9F9N2 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-phenyldiazene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C16H9F9N2/c17-13(18,14(19,20)15(21,22)16(23,24)25)10-6-8-12(9-7-10)27-26-11-4-2-1-3-5-11/h1-9H/b27-26+ |
| InChIKey | KDVPEGACWKOCKU-CYYJNZCTSA-N |
| XLogP | 7.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|