About benzene;formamide;4-octyl-9H-fluorene
benzene;formamide;4-octyl-9H-fluorene (PubChem CID 175052278) has the molecular formula C28H35NO
and a molecular weight of 401.59 g/mol. Its IUPAC name is benzene;formamide;4-octyl-9H-fluorene.
Molecular Properties
| Compound Name | benzene;formamide;4-octyl-9H-fluorene |
| PubChem CID | 175052278 |
| Molecular Formula | C28H35NO |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | benzene;formamide;4-octyl-9H-fluorene |
| SMILES | CCCCCCCCc1cccc2c1-c1ccccc1C2.NC=O.c1ccccc1 |
| InChI | InChI=1S/C21H26.C6H6.CH3NO/c1-2-3-4-5-6-7-11-17-13-10-14-19-16-18-12-8-9-15-20(18)21(17)19;1-2-4-6-5-3-1;2-1-3/h8-10,12-15H,2-7,11,16H2,1H3;1-6H;1H,(H2,2,3) |
| InChIKey | ZWBCGORWQBRLLD-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzene;formamide;4-octyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;formamide;4-octyl-9H-fluorene?
The IUPAC name of benzene;formamide;4-octyl-9H-fluorene (CID 175052278) is benzene;formamide;4-octyl-9H-fluorene.
What is the SMILES notation for benzene;formamide;4-octyl-9H-fluorene?
The canonical SMILES for benzene;formamide;4-octyl-9H-fluorene is CCCCCCCCc1cccc2c1-c1ccccc1C2.NC=O.c1ccccc1.
What is the InChIKey of benzene;formamide;4-octyl-9H-fluorene?
The InChIKey is ZWBCGORWQBRLLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26.C6H6.CH3NO/c1-2-3-4-5-6-7-11-17-13-10-14-19-16-18-12-8-9-15-20(18)21(17)19;1-2-4-6-5-3-1;2-1-3/h8-10,12-15H,2-7,11,16H2,1H3;1-6H;1H,(H2,2,3).
What are the key properties of benzene;formamide;4-octyl-9H-fluorene?
benzene;formamide;4-octyl-9H-fluorene has a molecular weight of 401.59 g/mol, XLogP of 6.95, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;formamide;4-octyl-9H-fluorene is sourced from PubChem (CID 175052278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).